Compounds
ID | Spectrum Quality | Annotated Name |
---|---|---|
CCMSLIB00000205143 | Bronze | Massbank:BML01015&Cytidine |
CCMSLIB00000205147 | Bronze | Massbank:BML01023&Cytidine |
CCMSLIB00000216243 | Bronze | Massbank:KNA00226&Cytidine |
CCMSLIB00000216245 | Bronze | Massbank:KNA00227&Cytidine |
CCMSLIB00000216333 | Bronze | Massbank:KNA00294&Cytidine |
CCMSLIB00000216335 | Bronze | Massbank:KNA00295&Cytidine |
CCMSLIB00000217699 | Bronze | Massbank:KO002602&Cytosine&arabinoside|Cytosine-1-beta-D-arabinofuranoside|Cytarabine |
CCMSLIB00000217701 | Bronze | Massbank:KO002603&Cytosine&arabinoside|Cytosine-1-beta-D-arabinofuranoside|Cytarabine |
CCMSLIB00000217703 | Bronze | Massbank:KO002604&Cytosine&arabinoside|Cytosine-1-beta-D-arabinofuranoside|Cytarabine |
CCMSLIB00000217705 | Bronze | Massbank:KO002605&Cytosine&arabinoside|Cytosine-1-beta-D-arabinofuranoside|Cytarabine |
CCMSLIB00000217707 | Bronze | Massbank:KO002606&Cytosine&arabinoside|Cytosine-1-beta-D-arabinofuranoside|Cytarabine |
CCMSLIB00000221145 | Bronze | Massbank:KO008896&Cytosine&arabinoside|Cytarabine|Cytosine-1-beta-D-arabinofuranoside |
CCMSLIB00000222945 | Bronze | Massbank:PR100115&Cytidine|Cyd|rC|Cytosine&beta-D-riboside|1-beta-D-Ribofuranoside&cytosine|4-Amino-1-beta-D-ribofuranosyl-2(1H)-pyrimidinone |
CCMSLIB00000222946 | Bronze | Massbank:PR100116&Cytidine|Cyd|rC|Cytosine&beta-D-riboside|1-beta-D-Ribofuranoside&cytosine|4-Amino-1-beta-D-ribofuranosyl-2(1H)-pyrimidinone |
CCMSLIB00000565355 | Bronze | MoNA:2245256&cytarabine |
CCMSLIB00000565357 | Bronze | MoNA:2245341&cytarabine |
CCMSLIB00000565361 | Bronze | MoNA:2245414&cytarabine |
CCMSLIB00000565739 | Bronze | MoNA:2245572&cytarabine |
CCMSLIB00000567448 | Bronze | MoNA:2453486&1-beta-D-arabinofuranosylcytosine |
CCMSLIB00000213458 | Bronze | ReSpect:PS018801&Cytidine,cell&culture&tested|Cyd|rC|Cytosine&beta-D-riboside|1-beta-D-Ribofuranoside&cytosine|4-Amino-1-beta-D-ribofuranosyl-2(1H)-pyrimidinone |
CCMSLIB00000213460 | Bronze | ReSpect:PS018802&Cytidine,cell&culture&tested|Cyd|rC|Cytosine&beta-D-riboside|1-beta-D-Ribofuranoside&cytosine|4-Amino-1-beta-D-ribofuranosyl-2(1H)-pyrimidinone |
CCMSLIB00000213462 | Bronze | ReSpect:PS018803&Cytidine,cell&culture&tested|Cyd|rC|Cytosine&beta-D-riboside|1-beta-D-Ribofuranoside&cytosine|4-Amino-1-beta-D-ribofuranosyl-2(1H)-pyrimidinone |
CCMSLIB00000213464 | Bronze | ReSpect:PS018804&Cytidine,cell&culture&tested|Cyd|rC|Cytosine&beta-D-riboside|1-beta-D-Ribofuranoside&cytosine|4-Amino-1-beta-D-ribofuranosyl-2(1H)-pyrimidinone |
CCMSLIB00000213466 | Bronze | ReSpect:PS018805&Cytidine,cell&culture&tested|Cyd|rC|Cytosine&beta-D-riboside|1-beta-D-Ribofuranoside&cytosine|4-Amino-1-beta-D-ribofuranosyl-2(1H)-pyrimidinone |
CCMSLIB00000213468 | Bronze | ReSpect:PS018806&Cytidine,cell&culture&tested|Cyd|rC|Cytosine&beta-D-riboside|1-beta-D-Ribofuranoside&cytosine|4-Amino-1-beta-D-ribofuranosyl-2(1H)-pyrimidinone |
CCMSLIB00000213469 | Bronze | ReSpect:PS018807&Cytidine,cell&culture&tested|Cyd|rC|Cytosine&beta-D-riboside|1-beta-D-Ribofuranoside&cytosine|4-Amino-1-beta-D-ribofuranosyl-2(1H)-pyrimidinone |
CCMSLIB00000220926 | Bronze | ReSpect:PT101880&Cytidine,cell&culture&tested|Cyd|rC|Cytosine&beta-D-riboside|1-beta-D-Ribofuranoside&cytosine|4-Amino-1-beta-D-ribofuranosyl-2(1H)-pyrimidinone|4-amino-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl) |
CCMSLIB00000220928 | Bronze | ReSpect:PT101883&Cytidine,cell&culture&tested|Cyd|rC|Cytosine&beta-D-riboside|1-beta-D-Ribofuranoside&cytosine|4-Amino-1-beta-D-ribofuranosyl-2(1H)-pyrimidinone|4-amino-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl) |
CCMSLIB00000221839 | Bronze | ReSpect:PT201880&Cytidine,cell&culture&tested|Cyd|rC|Cytosine&beta-D-riboside|1-beta-D-Ribofuranoside&cytosine|4-Amino-1-beta-D-ribofuranosyl-2(1H)-pyrimidinone|4-amino-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl) |
CCMSLIB00000425116 | Bronze | HMDB:HMDB00089-139&Cytidine |
CCMSLIB00000425553 | Bronze | HMDB:HMDB00089-140&Cytidine |
CCMSLIB00000426589 | Bronze | HMDB:HMDB00089-138&Cytidine |
CCMSLIB00000205138 | Bronze | Massbank:BML01007&Cytidine |
CCMSLIB00006385486 | Gold | 1 |
CCMSLIB00006385487 | Gold | 1 |
CCMSLIB00006385533 | Gold | 1 |
CCMSLIB00006385534 | Gold | 1 |
CCMSLIB00006385579 | Gold | 1 |
CCMSLIB00006385580 | Gold | 1 |
CCMSLIB00006385627 | Gold | 1 |
CCMSLIB00006385628 | Gold | 1 |
CCMSLIB00006385674 | Gold | 1 |
CCMSLIB00006385675 | Gold | 1 |
CCMSLIB00006385722 | Gold | 1 |
CCMSLIB00006385723 | Gold | 1 |
CCMSLIB00006385770 | Gold | 1 |
CCMSLIB00006385771 | Gold | 1 |
CCMSLIB00006385818 | Gold | 1 |
CCMSLIB00006385819 | Gold | 1 |
CCMSLIB00006385866 | Gold | 1 |
CCMSLIB00006385867 | Gold | 1 |
CCMSLIB00006385914 | Gold | 1 |
CCMSLIB00006385915 | Gold | 1 |
CCMSLIB00006385961 | Gold | 1 |
CCMSLIB00006385962 | Gold | 1 |
CCMSLIB00006386009 | Gold | 1 |
CCMSLIB00006386010 | Gold | 1 |
CCMSLIB00006386057 | Gold | 1 |
CCMSLIB00006386058 | Gold | 1 |
CCMSLIB00006386104 | Gold | 1 |
CCMSLIB00006386105 | Gold | 1 |
CCMSLIB00006386151 | Gold | 1 |
CCMSLIB00006386152 | Gold | 1 |
CCMSLIB00006386199 | Gold | 1 |
CCMSLIB00006386200 | Gold | 1 |
CCMSLIB00006386247 | Gold | 1 |
CCMSLIB00006386248 | Gold | 1 |
CCMSLIB00006386294 | Gold | 1 |
CCMSLIB00006386295 | Gold | 1 |
CCMSLIB00006386341 | Gold | 1 |
CCMSLIB00006386342 | Gold | 1 |
CCMSLIB00006386389 | Gold | 1 |
CCMSLIB00006386390 | Gold | 1 |
CCMSLIB00006386435 | Gold | 1 |
CCMSLIB00006386436 | Gold | 1 |
CCMSLIB00006386482 | Gold | 1 |
CCMSLIB00006386483 | Gold | 1 |
CCMSLIB00006386528 | Gold | 1 |
CCMSLIB00006386529 | Gold | 1 |
CCMSLIB00006386574 | Gold | 1 |
CCMSLIB00006386575 | Gold | 1 |
CCMSLIB00006386619 | Gold | 1 |
CCMSLIB00006386620 | Gold | 1 |
CCMSLIB00006386665 | Gold | 1 |
CCMSLIB00006386666 | Gold | 1 |
CCMSLIB00006386710 | Gold | 1 |
CCMSLIB00006386711 | Gold | 1 |
CCMSLIB00006386755 | Gold | 1 |
CCMSLIB00006386756 | Gold | 1 |
CCMSLIB00006386799 | Gold | 1 |
CCMSLIB00006386800 | Gold | 1 |
CCMSLIB00006386845 | Gold | 1 |
CCMSLIB00006386846 | Gold | 1 |
CCMSLIB00006386891 | Gold | 1 |
CCMSLIB00006386892 | Gold | 1 |
CCMSLIB00006386936 | Gold | 1 |
CCMSLIB00006386937 | Gold | 1 |
CCMSLIB00006386980 | Gold | 1 |
CCMSLIB00006386981 | Gold | 1 |
CCMSLIB00006387026 | Gold | 1 |
CCMSLIB00006387027 | Gold | 1 |
CCMSLIB00006387070 | Gold | 1 |
CCMSLIB00006387071 | Gold | 1 |
CCMSLIB00006387115 | Gold | 1 |
CCMSLIB00006387116 | Gold | 1 |
CCMSLIB00006387158 | Gold | 1 |
CCMSLIB00006387159 | Gold | 1 |
CCMSLIB00006387201 | Gold | 1 |
CCMSLIB00006387202 | Gold | 1 |
CCMSLIB00006387245 | Gold | 1 |
CCMSLIB00006387246 | Gold | 1 |
CCMSLIB00006387290 | Gold | 1 |
CCMSLIB00006387291 | Gold | 1 |
CCMSLIB00006557421 | Gold | 1 |
CCMSLIB00006557445 | Gold | 1 |
CCMSLIB00006557473 | Gold | 1 |
CCMSLIB00006557497 | Gold | 1 |
CCMSLIB00006557525 | Gold | 1 |
CCMSLIB00006557549 | Gold | 1 |
CCMSLIB00006557577 | Gold | 1 |
CCMSLIB00006557601 | Gold | 1 |
CCMSLIB00006557629 | Gold | 1 |
CCMSLIB00006557653 | Gold | 1 |
CCMSLIB00006557681 | Gold | 1 |
CCMSLIB00006557705 | Gold | 1 |
CCMSLIB00006557733 | Gold | 1 |
CCMSLIB00006557756 | Gold | 1 |
CCMSLIB00006557779 | Gold | 1 |
CCMSLIB00006557806 | Gold | 1 |
CCMSLIB00006557826 | Gold | 1 |
CCMSLIB00006557850 | Gold | 1 |
CCMSLIB00006557868 | Gold | 1 |
CCMSLIB00006557889 | Gold | 1 |
CCMSLIB00006557910 | Gold | 1 |
CCMSLIB00005464325 | Gold | 1!CCMSLIB00005464326 |
CCMSLIB00005720602 | Gold | 1 |
CCMSLIB00005720622 | Gold | 1 |
CCMSLIB00006679105 | Gold | 3 |
CCMSLIB00006679307 | Gold | 3 |
CCMSLIB00006679426 | Gold | 3 |
CCMSLIB00006681087 | Gold | 3 |
CCMSLIB00006682067 | Gold | 3 |
CCMSLIB00006682295 | Gold | 3 |
CCMSLIB00006682346 | Gold | 3 |
CCMSLIB00006682495 | Gold | 3 |
CCMSLIB00006682565 | Gold | 3 |
CCMSLIB00006682655 | Gold | 3 |
CCMSLIB00006682888 | Gold | 3 |
CCMSLIB00006683091 | Gold | 3 |
CCMSLIB00005883634 | Gold | 1 |
CCMSLIB00005883635 | Gold | 1 |
CCMSLIB00005883636 | Gold | 1 |
CCMSLIB00005883637 | Gold | 1 |
CCMSLIB00005883638 | Gold | 1 |
CCMSLIB00005883639 | Gold | 1 |
CCMSLIB00006121189 | Gold | 1 |
CCMSLIB00006121191 | Gold | 1 |
CCMSLIB00006121193 | Gold | 1 |
CCMSLIB00006121195 | Gold | 1 |
CCMSLIB00006121197 | Gold | 1 |
CCMSLIB00006124337 | Gold | 1 |
CCMSLIB00006124351 | Gold | 1 |
CCMSLIB00006124354 | Gold | 1 |
CCMSLIB00006124356 | Gold | 1 |
CCMSLIB00006124358 | Gold | 1 |
CCMSLIB00006124360 | Gold | 1 |
CCMSLIB00006121176 | Gold | 1 |
CCMSLIB00006121177 | Gold | 1 |
CCMSLIB00006121179 | Gold | 1 |
CCMSLIB00006121181 | Gold | 1 |
CCMSLIB00006121183 | Gold | 1 |
CCMSLIB00006121185 | Gold | 1 |
CCMSLIB00006121186 | Gold | 1 |
CCMSLIB00006121188 | Gold | 1 |
CCMSLIB00006124326 | Gold | 1 |
CCMSLIB00006124328 | Gold | 1 |
CCMSLIB00006124330 | Gold | 1 |
CCMSLIB00006124332 | Gold | 1 |
CCMSLIB00006124335 | Gold | 1 |
CCMSLIB00006124340 | Gold | 1 |
CCMSLIB00006124342 | Gold | 1 |
CCMSLIB00006124344 | Gold | 1 |
CCMSLIB00006124347 | Gold | 1 |
CCMSLIB00006124349 | Gold | 1 |
CCMSLIB00005755262 | Gold | 3 |
CCMSLIB00005755264 | Gold | 3 |
CCMSLIB00005771815 | Gold | 3 |
CCMSLIB00005777497 | Gold | 3 |
CCMSLIB00005777415 | Gold | 3 |
CCMSLIB00005777506 | Gold | 3 |
CCMSLIB00005777450 | Gold | 3 |
CCMSLIB00005727954 | Gold | 3 |
CCMSLIB00005729891 | Gold | 3 |
CCMSLIB00005728788 | Gold | 3 |
CCMSLIB00005729924 | Gold | 3 |
CCMSLIB00005729060 | Gold | 3 |
CCMSLIB00005741361 | Gold | 3 |
CCMSLIB00005757084 | Gold | 3 |
CCMSLIB00005757929 | Gold | 3 |
CCMSLIB00005759687 | Gold | 3 |
CCMSLIB00005756224 | Gold | 3 |
CCMSLIB00005757967 | Gold | 3 |
CCMSLIB00005758598 | Gold | 3 |
CCMSLIB00005756658 | Gold | 3 |
CCMSLIB00005759673 | Gold | 3 |
CCMSLIB00005758008 | Gold | 3 |
CCMSLIB00005758798 | Gold | 3 |
CCMSLIB00012105440 | Gold | 4 |
CCMSLIB00009945237 | Gold | 4 |
CCMSLIB00006581647 | Gold | 1 |
CCMSLIB00010102561 | Gold | 3 |
CCMSLIB00010102562 | Gold | 3 |
CCMSLIB00010102563 | Gold | 3 |
CCMSLIB00010103027 | Gold | 3 |
CCMSLIB00010103028 | Gold | 3 |
CCMSLIB00010103029 | Gold | 3 |
CCMSLIB00010103030 | Gold | 3 |
CCMSLIB00010126176 | Gold | 3 |
CCMSLIB00010126177 | Gold | 3 |
CCMSLIB00010126178 | Gold | 3 |
CCMSLIB00010126642 | Gold | 3 |
CCMSLIB00010126643 | Gold | 3 |
CCMSLIB00010126644 | Gold | 3 |
CCMSLIB00010126645 | Gold | 3 |
COMPOUND NPA013353
PROPERTIES
NPAID | NPA013353 |
---|---|
CLUSTER ID | 2123 |
NODE ID | 1695 |
NAME | 1-β-D-Arabinofuranosylcytosine |
FORMULA | C9H13N3O5 |
MOLECULAR WEIGHT (Da) | 243.2190 |
ACCURATE MASS (Da) | 243.0855 |
ORIGIN ORGANISM TYPE | Fungus |
ORIGIN GENUS | Xerocomus |
ORIGIN SPECIES | nigromaculatus HONGO |
InChIKey | UHDGCWIWMRVCDJ-UHFFFAOYSA-N |
InChI | InChI=1S/C9H13N3O5/c10-5-1-2-12(9(16)11-5)8-7(15)6(14)4(3-13)17-8/h1-2,4,6-8,13-15H,3H2,(H2,10,11,16) |
SMILES | C1=CN(C(=O)N=C1N)C2C(C(C(O2)CO)O)O |
ORIGINAL ISOLATION REFERENCE
CITATION | TAKAHASHI, Akira; NUNOZAWA, Tetsuji; ENDO, Takeshi; NOZOE, Shigeo Isolation of 1-β-D-Arabinofuranosylcytosine from the Mushroom Xerocomus nigromaculatus HONGO Chemical and Pharmaceutical Bulletin 1992 40 (5) 1313-1314. | ||
---|---|---|---|
DOI | 10.1248/cpb.40.1313 | PMID | 1394652 |